Difference between revisions of "SJ18340"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == * common-name: ** β-d-mannosyl-(c55 ω-saturated dolichyl pho...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carotenoid-psi-end-group Carotenoid-psi-end-group] == * common-name: ** a carotenoid ψ-end...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carotenoid-psi-end-group Carotenoid-psi-end-group] ==
 
* common-name:
 
* common-name:
−
** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
+
** a carotenoid ψ-end group
−
* smiles:
 
−
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
 
−
* inchi-key:
 
−
** mbyvktiiznuhkn-nivaaieqsa-m
 
−
* molecular-weight:
 
−
** 1012.461
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12496]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16602]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)}}
+
{{#set: common-name=a carotenoid ψ-end group}}
−
{{#set: inchi-key=inchikey=mbyvktiiznuhkn-nivaaieqsa-m}}
 
−
{{#set: molecular-weight=1012.461}}
 

Revision as of 14:20, 26 August 2019

Metabolite Carotenoid-psi-end-group

  • common-name:
    • a carotenoid ψ-end group

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ18340&oldid=16032"