Difference between revisions of "SJ11229"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** gdp-α-d-glucose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mvmscbbuihutgj-lrjdveewsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 603.329 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12486]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-12486]] | |
| − | * [[RXN- | + | * [[RXN4FS-13]] |
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gdp-α-d-glucose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=603.329}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite GDP-D-GLUCOSE
- common-name:
- gdp-α-d-glucose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
- inchi-key:
- mvmscbbuihutgj-lrjdveewsa-l
- molecular-weight:
- 603.329
