Difference between revisions of "SJ19606"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * common-name: ** 2,3-diphospho-d-glycerate * s...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * common-name: ** quercetin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == |
* common-name: | * common-name: | ||
| − | ** | + | ** quercetin |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c=2[o-])c(o)=cc(o)=c3))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** refjwtpedvjjiy-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 301.232 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[QUERCETIN-23-DIOXYGENASE-RXN]] |
| − | * [[ | + | * [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]] |
| − | + | * [[RXN1F-462]] | |
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-12510]] | |
| − | + | * [[RXN-527]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=quercetin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=refjwtpedvjjiy-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=301.232}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-520
- common-name:
- quercetin
- smiles:
- c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c=2[o-])c(o)=cc(o)=c3)))
- inchi-key:
- refjwtpedvjjiy-uhfffaoysa-m
- molecular-weight:
- 301.232
