Difference between revisions of "SJ20061"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-O-SINAPOYL-BETA-D-GLUCOSE 1-O-SINAPOYL-BETA-D-GLUCOSE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-N4-Methylcytosine DNA-N4-Methylcytosine] ==
 * common-name:
-** 1-o-sinapoyl-&beta;-d-glucose
+** an n4-methylcytosine in dna
-* smiles:
-** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc)
-* inchi-key:
-** xrkbrpftfkkhef-dgdbgzaxsa-n
-* molecular-weight:
-** 386.355
 == Reaction(s) known to consume the compound ==
-* [[2.3.1.91-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[2.1.1.113-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-o-sinapoyl-&beta;-d-glucose}}
+{{#set: common-name=an n4-methylcytosine in dna}}
-{{#set: inchi-key=inchikey=xrkbrpftfkkhef-dgdbgzaxsa-n}}
-{{#set: molecular-weight=386.355}}