Difference between revisions of "SJ22506"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04004 == * transcription-direction: ** negative * right-end-position: ** 388870 * left-end-position: ** 359555 * centisome-position: ** 69.34322...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4441 CPD-4441] == * common-name: ** cis-zeatin * smiles: ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4441 CPD-4441] == |
− | * | + | * common-name: |
− | ** | + | ** cis-zeatin |
− | * | + | * smiles: |
− | ** | + | ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) |
− | * | + | * inchi-key: |
− | ** | + | ** uzkqtcbamswpjd-uqcoibpssa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 219.246 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-4733]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=cis-zeatin}} | |
− | + | {{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}} | |
− | + | {{#set: molecular-weight=219.246}} | |
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-4441
- common-name:
- cis-zeatin
- smiles:
- cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
- inchi-key:
- uzkqtcbamswpjd-uqcoibpssa-n
- molecular-weight:
- 219.246