Difference between revisions of "SJ22506"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04004 == * transcription-direction: ** negative * right-end-position: ** 388870 * left-end-position: ** 359555 * centisome-position: ** 69.34322...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4441 CPD-4441] == * common-name: ** cis-zeatin * smiles: ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ04004 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4441 CPD-4441] ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** cis-zeatin
−
* right-end-position:
+
* smiles:
−
** 388870
+
** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
−
* left-end-position:
+
* inchi-key:
−
** 359555
+
** uzkqtcbamswpjd-uqcoibpssa-n
−
* centisome-position:
+
* molecular-weight:
−
** 69.34322   
+
** 219.246
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-4733]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[PEPCARBOX-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=cis-zeatin}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=219.246}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PPC]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[PWY-7124]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-6549]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-1622]]
 
−
** '''6''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-7117]]
 
−
** '''10''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-7115]]
 
−
** '''9''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-241]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5913]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-6142]]
 
−
** '''10''' reactions found over '''13''' reactions in the full pathway
 
−
* [[P23-PWY]]
 
−
** '''9''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWYQT-4429]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6146]]
 
−
** '''9''' reactions found over '''2''' reactions in the full pathway
 
−
* [[FERMENTATION-PWY]]
 
−
** '''11''' reactions found over '''16''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=388870}}
 
−
{{#set: left-end-position=359555}}
 
−
{{#set: centisome-position=69.34322    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=12}}
 

Revision as of 14:20, 26 August 2019

Metabolite CPD-4441

  • common-name:
    • cis-zeatin
  • smiles:
    • cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
  • inchi-key:
    • uzkqtcbamswpjd-uqcoibpssa-n
  • molecular-weight:
    • 219.246

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ22506&oldid=16191"