Difference between revisions of "SJ14053"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=biotin-L-lysine-in-BCCP-dimers biotin-L-lysine-in-BCCP-dimers] == * common-name: ** a [biotin c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=biotin-L-lysine-in-BCCP-dimers biotin-L-lysine-in-BCCP-dimers] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] ==
 
* common-name:
 
* common-name:
** a [biotin carboxyl-carrier-protein dimer]-n6-biotinyl-l-lysine
+
** nicotinate adenine dinucleotide
 +
* smiles:
 +
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
 +
* inchi-key:
 +
** senpvezbrzqvst-hisdbwnosa-l
 +
* molecular-weight:
 +
** 662.399
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BIOTIN-CARBOXYL-RXN]]
+
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[NAD-SYNTH-NH3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5055]]
+
* [[NICONUCADENYLYLTRAN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [biotin carboxyl-carrier-protein dimer]-n6-biotinyl-l-lysine}}
+
{{#set: common-name=nicotinate adenine dinucleotide}}
 +
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}
 +
{{#set: molecular-weight=662.399}}

Revision as of 14:20, 26 August 2019

Metabolite DEAMIDO-NAD

  • common-name:
    • nicotinate adenine dinucleotide
  • smiles:
    • c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
  • inchi-key:
    • senpvezbrzqvst-hisdbwnosa-l
  • molecular-weight:
    • 662.399

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality