Difference between revisions of "SJ14053"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=biotin-L-lysine-in-BCCP-dimers biotin-L-lysine-in-BCCP-dimers] == * common-name: ** a [biotin c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == |
* common-name: | * common-name: | ||
− | ** | + | ** nicotinate adenine dinucleotide |
+ | * smiles: | ||
+ | ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o) | ||
+ | * inchi-key: | ||
+ | ** senpvezbrzqvst-hisdbwnosa-l | ||
+ | * molecular-weight: | ||
+ | ** 662.399 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[NAD-SYNTH-GLN-RXN]] |
+ | * [[NAD-SYNTH-NH3-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[NICONUCADENYLYLTRAN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=nicotinate adenine dinucleotide}} |
+ | {{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}} | ||
+ | {{#set: molecular-weight=662.399}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite DEAMIDO-NAD
- common-name:
- nicotinate adenine dinucleotide
- smiles:
- c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
- inchi-key:
- senpvezbrzqvst-hisdbwnosa-l
- molecular-weight:
- 662.399