Difference between revisions of "5Z8Z11Z14Z17Z-EICOSAPENTAENOATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03446 == * transcription-direction: ** positive * right-end-position: ** 79434 * left-end-position: ** 70275 * centisome-position: ** 58.11934...") |
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_NUCLEOTIDE == * common-name: ** β-nicotinamide d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite NICOTINAMIDE_NUCLEOTIDE == |
− | * | + | * common-name: |
− | ** | + | ** β-nicotinamide d-ribonucleotide |
− | * | + | * smiles: |
− | ** | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) |
− | * | + | * inchi-key: |
− | ** | + | ** dayljwodmcoqew-turqnecasa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 333.214 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2.7.7.1-RXN]] |
− | + | * [[RXN-5841]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[DNA-LIGASE-NAD+-RXN]] | |
− | * | + | * [[NADPYROPHOSPHAT-RXN]] |
− | + | * [[RXN-17920]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=β-nicotinamide d-ribonucleotide}} | |
− | + | {{#set: inchi-key=inchikey=dayljwodmcoqew-turqnecasa-m}} | |
− | * [[ | + | {{#set: molecular-weight=333.214}} |
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite NICOTINAMIDE_NUCLEOTIDE
- common-name:
- β-nicotinamide d-ribonucleotide
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
- inchi-key:
- dayljwodmcoqew-turqnecasa-m
- molecular-weight:
- 333.214