Difference between revisions of "CPD-578"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08074 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite P-COUMAROYL-COA == |
− | == | + | * common-name: |
− | + | ** 4-coumaroyl-coa | |
− | = | + | * smiles: |
− | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | |
− | ** | + | * inchi-key: |
− | *** | + | ** dmzokbalnzwdki-matmfaihsa-j |
− | * [[RXN- | + | * molecular-weight: |
− | * | + | ** 909.648 |
− | * | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] |
− | * [[ | + | * [[RXN-1101]] |
− | + | * [[RXN-11244]] | |
− | {{#set: | + | * [[RXN-3142]] |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | {{#set: | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=4-coumaroyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}} | ||
+ | {{#set: molecular-weight=909.648}} |
Revision as of 20:30, 18 December 2020
Contents
Metabolite P-COUMAROYL-COA
- common-name:
- 4-coumaroyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- dmzokbalnzwdki-matmfaihsa-j
- molecular-weight:
- 909.648