Difference between revisions of "L-3-HYDROXYACYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07175 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 6.3.2.25-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite DIHYDRO-NEO-PTERIN == * common-name: ** 7,8-dihydroneopterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifam...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DIHYDRO-NEO-PTERIN == |
− | == | + | * common-name: |
− | * [[ | + | ** 7,8-dihydroneopterin |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) |
− | + | * inchi-key: | |
− | + | ** yqifamynggotfb-xinawcovsa-n | |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 255.233 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[H2NEOPTERINALDOL-RXN]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=7,8-dihydroneopterin}} | ||
+ | {{#set: inchi-key=inchikey=yqifamynggotfb-xinawcovsa-n}} | ||
+ | {{#set: molecular-weight=255.233}} |
Revision as of 20:30, 18 December 2020
Contents
Metabolite DIHYDRO-NEO-PTERIN
- common-name:
- 7,8-dihydroneopterin
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
- inchi-key:
- yqifamynggotfb-xinawcovsa-n
- molecular-weight:
- 255.233