Difference between revisions of "CPD1F-138"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01800 == * transcription-direction: ** negative * right-end-position: ** 20720 * left-end-position: ** 3580 * centisome-position: ** 2.4627154...")
(Created page with "Category:metabolite == Metabolite 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE == * common-name: ** 2-carboxy-d-arabinitol 1-phosphate * smiles: ** c(c(c(c(cop([o-])([o-])=o)(c([o...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ01800 ==
+
== Metabolite 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE ==
* transcription-direction:
+
* common-name:
** negative
+
** 2-carboxy-d-arabinitol 1-phosphate
* right-end-position:
+
* smiles:
** 20720
+
** c(c(c(c(cop([o-])([o-])=o)(c([o-])=o)o)o)o)o
* left-end-position:
+
* inchi-key:
** 3580
+
** ujtmirnfexkgms-uhfffaoysa-k
* centisome-position:
+
* molecular-weight:
** 2.4627154   
+
** 273.113
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=2-carboxy-d-arabinitol 1-phosphate}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ujtmirnfexkgms-uhfffaoysa-k}}
* [[RXN-14518]]
+
{{#set: molecular-weight=273.113}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7286]]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=20720}}
 
{{#set: left-end-position=3580}}
 
{{#set: centisome-position=2.4627154    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=1}}
 

Revision as of 20:30, 18 December 2020

Metabolite 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE

  • common-name:
    • 2-carboxy-d-arabinitol 1-phosphate
  • smiles:
    • c(c(c(c(cop([o-])([o-])=o)(c([o-])=o)o)o)o)o
  • inchi-key:
    • ujtmirnfexkgms-uhfffaoysa-k
  • molecular-weight:
    • 273.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality