Difference between revisions of "Cyclic-Phosphate-Terminated-RNAs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11301 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * AIRCARBOXY-RXN ** Cate...") |
(Created page with "Category:metabolite == Metabolite CREATINE-P == * common-name: ** nω-phosphocreatine * smiles: ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+] * inchi-key: ** drbbfclwyr...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CREATINE-P == |
− | == | + | * common-name: |
− | * | + | ** nω-phosphocreatine |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+] |
− | + | * inchi-key: | |
− | + | ** drbbfclwyrjsjz-uhfffaoysa-l | |
− | == | + | * molecular-weight: |
− | * [[ | + | ** 209.098 |
− | + | == Reaction(s) known to consume the compound == | |
− | {{#set: | + | * [[CREATINE-KINASE-RXN]] |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | {{#set: | + | * [[CREATINE-KINASE-RXN]] |
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=nω-phosphocreatine}} | ||
+ | {{#set: inchi-key=inchikey=drbbfclwyrjsjz-uhfffaoysa-l}} | ||
+ | {{#set: molecular-weight=209.098}} |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CREATINE-P
- common-name:
- nω-phosphocreatine
- smiles:
- c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+]
- inchi-key:
- drbbfclwyrjsjz-uhfffaoysa-l
- molecular-weight:
- 209.098