Difference between revisions of "2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18424 == * transcription-direction: ** negative * right-end-position: ** 97427 * left-end-position: ** 89898 * centisome-position: ** 36.436226...")
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common-name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakd...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18424 ==
+
== Metabolite CPD-15318 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** α-d-ribose 5-phosphate
−
* right-end-position:
+
* smiles:
−
** 97427
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
−
* left-end-position:
+
* inchi-key:
−
** 89898
+
** ktvpxoyakdprhy-aihaylrmsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 36.436226   
+
** 228.095
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[R5PDP]]
−
== Reaction(s) associated ==
+
* [[RPDPK]]
−
* [[GPPSYN-RXN]]
+
* [[RXN-14456]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ARDP]]
−
* [[RXN-3701]]
+
* [[RIBOKIN-RXN]]
−
** Category: [[annotation]]
+
* [[RPDPK]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14456]]
−
== Pathway(s) associated ==
+
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-6383]]
+
{{#set: common-name=&alpha;-d-ribose 5-phosphate}}
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=ktvpxoyakdprhy-aihaylrmsa-l}}
−
* [[PWY-7410]]
+
{{#set: molecular-weight=228.095}}
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7102]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6859]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7736]]
 
−
** '''3''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5122]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-7141]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7659]]
 
−
** '''1''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7709]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-5123]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7182]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=97427}}
 
−
{{#set: left-end-position=89898}}
 
−
{{#set: centisome-position=36.436226    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=11}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-15318

  • common-name:
    • α-d-ribose 5-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
  • inchi-key:
    • ktvpxoyakdprhy-aihaylrmsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE&oldid=45595"