Difference between revisions of "CPD-7836"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05681 == * transcription-direction: ** positive * right-end-position: ** 26992 * left-end-position: ** 23983 * centisome-position: ** 26.76704...")
(Created page with "Category:metabolite == Metabolite HEXANOYL-COA == * common-name: ** hexanoyl-coa * smiles: ** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05681 ==
+
== Metabolite HEXANOYL-COA ==
* transcription-direction:
+
* common-name:
** positive
+
** hexanoyl-coa
* right-end-position:
+
* smiles:
** 26992
+
** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 23983
+
** oexfmsfodmqepe-hdrqghtbsa-j
* centisome-position:
+
* molecular-weight:
** 26.76704   
+
** 861.647
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]]
== Reaction(s) associated ==
+
* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
* [[RXN-11356]]
+
* [[RXN-14277]]
** Category: [[annotation]]
+
* [[RXN-14278]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]
* [[RXN-11357]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-12559]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14277]]
* [[RXN-12242]]
+
* [[RXN-14278]]
** Category: [[annotation]]
+
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) associated ==
+
{{#set: common-name=hexanoyl-coa}}
* [[PWY-6475]]
+
{{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}}
** '''8''' reactions found over '''8''' reactions in the full pathway
+
{{#set: molecular-weight=861.647}}
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=26992}}
 
{{#set: left-end-position=23983}}
 
{{#set: centisome-position=26.76704    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=1}}
 

Revision as of 20:30, 18 December 2020

Metabolite HEXANOYL-COA

  • common-name:
    • hexanoyl-coa
  • smiles:
    • cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oexfmsfodmqepe-hdrqghtbsa-j
  • molecular-weight:
    • 861.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality