Difference between revisions of "CPD-7066"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02158 == * transcription-direction: ** negative * right-end-position: ** 86926 * left-end-position: ** 66672 * centisome-position: ** 47.515945...")
(Created page with "Category:metabolite == Metabolite CPD-4201 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02158 ==
+
== Metabolite CPD-4201 ==
* transcription-direction:
+
* common-name:
** negative
+
** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
* right-end-position:
+
* smiles:
** 86926
+
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
* left-end-position:
+
* inchi-key:
** 66672
+
** oplvztyvquwkhb-sdbhatresa-k
* centisome-position:
+
* molecular-weight:
** 47.515945   
+
** 572.278
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-4303]]
* [[RXN-16889]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-triphosphate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=oplvztyvquwkhb-sdbhatresa-k}}
* [[RXN-16892]]
+
{{#set: molecular-weight=572.278}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-17120]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=86926}}
 
{{#set: left-end-position=66672}}
 
{{#set: centisome-position=47.515945    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-4201

  • common-name:
    • n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
  • smiles:
    • cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
  • inchi-key:
    • oplvztyvquwkhb-sdbhatresa-k
  • molecular-weight:
    • 572.278

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality