Difference between revisions of "CPD-535"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01012 == * transcription-direction: ** positive * right-end-position: ** 17442 * left-end-position: ** 647 * centisome-position: ** 0.40875638...")
(Created page with "Category:metabolite == Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE == * common-name: ** (s)-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(cc(=nc(c1)c([o-])=o)c([o-])=...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01012 ==
+
== Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (s)-2,3,4,5-tetrahydrodipicolinate
−
* right-end-position:
+
* smiles:
−
** 17442
+
** c1(cc(=nc(c1)c([o-])=o)c([o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 647
+
** cxmbcxqhoxuceo-bypyzucnsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 0.40875638   
+
** 169.137
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14246]]
−
== Reaction(s) associated ==
+
* [[RXN-7737]]
−
* [[RXN-14971]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-14014]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14246]]
−
** Category: [[orthology]]
+
* [[RXN-7737]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-15378]]
+
{{#set: common-name=(s)-2,3,4,5-tetrahydrodipicolinate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=cxmbcxqhoxuceo-bypyzucnsa-l}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=169.137}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[PWY-6969]]
 
−
** '''10''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-5690]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[P105-PWY]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[TCA]]
 
−
** '''9''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-7254]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-561]]
 
−
** '''6''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6728]]
 
−
** '''11''' reactions found over '''19''' reactions in the full pathway
 
−
* [[PWY-3781]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7279]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY66-398]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-4302]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY0-1329]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY0-1353]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=17442}}
 
−
{{#set: left-end-position=647}}
 
−
{{#set: centisome-position=0.40875638    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=13}}
 

Revision as of 20:30, 18 December 2020

Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE

  • common-name:
    • (s)-2,3,4,5-tetrahydrodipicolinate
  • smiles:
    • c1(cc(=nc(c1)c([o-])=o)c([o-])=o)
  • inchi-key:
    • cxmbcxqhoxuceo-bypyzucnsa-l
  • molecular-weight:
    • 169.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-535&oldid=45827"