Difference between revisions of "CPD-729"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16195 == * transcription-direction: ** negative * right-end-position: ** 139212 * left-end-position: ** 132198 * centisome-position: ** 46.189003...") |
(Created page with "Category:metabolite == Metabolite CPD-17324 == * common-name: ** 3-oxo adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-17324 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-oxo adrenoyl-coa |
| − | + | * smiles: | |
| − | + | ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
| − | * | + | * inchi-key: |
| − | ** | + | ** vmajwsswcpbijy-kpovblhlsa-j |
| − | + | * molecular-weight: | |
| − | + | ** 1091.996 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-16112]] | |
| − | = | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=3-oxo adrenoyl-coa}} |
| − | ** | + | {{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}} |
| − | * | + | {{#set: molecular-weight=1091.996}} |
| − | ** | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-17324
- common-name:
- 3-oxo adrenoyl-coa
- smiles:
- cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- vmajwsswcpbijy-kpovblhlsa-j
- molecular-weight:
- 1091.996
