Difference between revisions of "Supercoiled-Duplex-DNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17788 == * transcription-direction: ** negative * right-end-position: ** 88228 * left-end-position: ** 77118 * centisome-position: ** 30.148596...")
(Created page with "Category:metabolite == Metabolite CPD-1103 == * common-name: ** taxiphyllin * smiles: ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n) * inchi-key: ** nvltyojhpbmilu-gmdx...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17788 ==
+
== Metabolite CPD-1103 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** taxiphyllin
−
* right-end-position:
+
* smiles:
−
** 88228
+
** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n)
−
* left-end-position:
+
* inchi-key:
−
** 77118
+
** nvltyojhpbmilu-gmdxdwkasa-n
−
* centisome-position:
+
* molecular-weight:
−
** 30.148596   
+
** 311.291
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13600]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=taxiphyllin}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=nvltyojhpbmilu-gmdxdwkasa-n}}
−
* [[ACID-PHOSPHATASE-RXN]]
+
{{#set: molecular-weight=311.291}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-5822]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6348]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[NAD-BIOSYNTHESIS-II]]
 
−
** '''4''' reactions found over '''3''' reactions in the full pathway
 
−
* [[NADPHOS-DEPHOS-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5083]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=88228}}
 
−
{{#set: left-end-position=77118}}
 
−
{{#set: centisome-position=30.148596    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-1103

  • common-name:
    • taxiphyllin
  • smiles:
    • c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n)
  • inchi-key:
    • nvltyojhpbmilu-gmdxdwkasa-n
  • molecular-weight:
    • 311.291

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Supercoiled-Duplex-DNAs&oldid=45913"