Difference between revisions of "SJ13513"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15802 == * transcription-direction: ** positive * right-end-position: ** 283557 * left-end-position: ** 267083 * centisome-position: ** 38.47854...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] == * common-name: ** 2,4-dihydroxyhept-2-enedioate * smiles: ** c(=o)([o-]...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ15802 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] ==
* transcription-direction:
+
* common-name:
** positive
+
** 2,4-dihydroxyhept-2-enedioate
* right-end-position:
+
* smiles:
** 283557
+
** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
* left-end-position:
+
* inchi-key:
** 267083
+
** apnidhdqyiszae-hyxafxhysa-l
* centisome-position:
+
* molecular-weight:
** 38.47854   
+
** 188.137
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14146]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN-14146]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=2,4-dihydroxyhept-2-enedioate}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=apnidhdqyiszae-hyxafxhysa-l}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=188.137}}
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=283557}}
 
{{#set: left-end-position=267083}}
 
{{#set: centisome-position=38.47854    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 14:20, 26 August 2019

Metabolite CPD-15125

  • common-name:
    • 2,4-dihydroxyhept-2-enedioate
  • smiles:
    • c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
  • inchi-key:
    • apnidhdqyiszae-hyxafxhysa-l
  • molecular-weight:
    • 188.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality