Difference between revisions of "CPD-1823"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14239 == * transcription-direction: ** positive * right-end-position: ** 62899 * left-end-position: ** 61799 * centisome-position: ** 19.120386...") |
(Created page with "Category:metabolite == Metabolite SINAPALDEHYDE == * common-name: ** sinapaldehyde * smiles: ** coc1(c=c(c=cc=o)c=c(oc)c(o)=1) * inchi-key: ** cdicdsogtrchmg-onegzznksa-n...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite SINAPALDEHYDE == |
| − | * | + | * common-name: |
| − | ** | + | ** sinapaldehyde |
| − | * | + | * smiles: |
| − | ** | + | ** coc1(c=c(c=cc=o)c=c(oc)c(o)=1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** cdicdsogtrchmg-onegzznksa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 208.213 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-1124]] |
| − | == Reaction(s) | + | * [[RXN-1125]] |
| − | * [[ | + | * [[RXN-8014]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-1124]] | |
| − | {{#set: | + | * [[RXN-1143]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=sinapaldehyde}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=cdicdsogtrchmg-onegzznksa-n}} |
| − | + | {{#set: molecular-weight=208.213}} | |
| − | |||
Revision as of 20:31, 18 December 2020
Contents
Metabolite SINAPALDEHYDE
- common-name:
- sinapaldehyde
- smiles:
- coc1(c=c(c=cc=o)c=c(oc)c(o)=1)
- inchi-key:
- cdicdsogtrchmg-onegzznksa-n
- molecular-weight:
- 208.213
