Difference between revisions of "Decanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01091 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PINA1th ** Category: [...") |
(Created page with "Category:metabolite == Metabolite XANTHINE == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi-key: ** lrfvtywoqmyalw-uhfffaoysa-n * molecular-wei...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite XANTHINE == |
− | == | + | * common-name: |
− | * | + | ** xanthine |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c12(nc(=o)nc(c=1n=cn2)=o) |
− | * | + | * inchi-key: |
− | * | + | ** lrfvtywoqmyalw-uhfffaoysa-n |
− | * [[ | + | * molecular-weight: |
− | * | + | ** 152.112 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-901]] |
− | * | + | * [[XANTHINE-OXIDASE-RXN]] |
− | * | + | * [[XNDH]] |
− | * [[ | + | * [[XPPRT]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[GUANINE-DEAMINASE-RXN]] | |
− | + | * [[RXN-7682]] | |
− | {{#set: | + | * [[RXN0-363]] |
− | {{#set: | + | * [[RXN0-901]] |
+ | * [[XANDH]] | ||
+ | * [[XANTHOSINEPHOSPHORY-RXN]] | ||
+ | * [[XPPRT]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=xanthine}} | ||
+ | {{#set: inchi-key=inchikey=lrfvtywoqmyalw-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=152.112}} |
Revision as of 20:31, 18 December 2020
Contents
Metabolite XANTHINE
- common-name:
- xanthine
- smiles:
- c12(nc(=o)nc(c=1n=cn2)=o)
- inchi-key:
- lrfvtywoqmyalw-uhfffaoysa-n
- molecular-weight:
- 152.112