Difference between revisions of "Long-Chain-oxoacyl-CoAs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02824 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * MALTODEXGLUCOSID-RXN *...") |
(Created page with "Category:metabolite == Metabolite DUMP == * common-name: ** dump * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** jsrljpsbldheio-shyzeuofs...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DUMP == |
| − | + | * common-name: | |
| − | * | + | ** dump |
| − | + | * smiles: | |
| − | * | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** jsrljpsbldheio-shyzeuofsa-l |
| − | * | + | * molecular-weight: |
| − | + | ** 306.168 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[MDUMT]] |
| − | ** | + | * [[RXN-14143]] |
| − | * | + | * [[THYMIDYLATESYN-RXN]] |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[DCMP-DEAMINASE-RXN]] |
| − | + | * [[DUTNH]] | |
| − | * [[RXN | + | * [[DUTP-PYROP-RXN]] |
| − | * | + | * [[MDUMT]] |
| − | * | + | * [[RXN-14199]] |
| − | * [[ | + | * [[RXN-14220]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=dump}} |
| − | == | + | {{#set: inchi-key=inchikey=jsrljpsbldheio-shyzeuofsa-l}} |
| − | + | {{#set: molecular-weight=306.168}} | |
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Revision as of 20:31, 18 December 2020
Contents
Metabolite DUMP
- common-name:
- dump
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
- inchi-key:
- jsrljpsbldheio-shyzeuofsa-l
- molecular-weight:
- 306.168
