Difference between revisions of "D-Xylopyranose"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04039 == * transcription-direction: ** negative * right-end-position: ** 62580 * left-end-position: ** 59649 * centisome-position: ** 53.112923...") |
(Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * smiles: ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) * inchi-key: ** sbjkkffyizucet-sz...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite L-DEHYDRO-ASCORBATE == |
| − | * | + | * common-name: |
| − | ** | + | ** l-dehydro-ascorbate |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** sbjkkffyizucet-szscbosdsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 174.11 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[1.8.5.1-RXN]] | |
| − | == Reaction(s) | + | * [[RXN-13185]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] |
| − | + | * [[ETHYL-RXN]] | |
| − | * [[ | + | * [[RXN-12440]] |
| − | * | + | * [[RXN-13185]] |
| − | * | + | * [[RXN-19200]] |
| − | * | + | * [[RXN-7984]] |
| − | * | + | * [[RXN-7985]] |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=l-dehydro-ascorbate}} |
| − | + | {{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}} | |
| − | == | + | {{#set: molecular-weight=174.11}} |
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:31, 18 December 2020
Contents
Metabolite L-DEHYDRO-ASCORBATE
- common-name:
- l-dehydro-ascorbate
- smiles:
- c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
- inchi-key:
- sbjkkffyizucet-szscbosdsa-n
- molecular-weight:
- 174.11
