Difference between revisions of "S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06815 == * transcription-direction: ** negative * right-end-position: ** 50302 * left-end-position: ** 36386 * centisome-position: ** 48.66 ==...") |
(Created page with "Category:metabolite == Metabolite DCDP == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o * inchi-key: ** ftdhdkpuhblb...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DCDP == |
− | * | + | * common-name: |
− | ** | + | ** dcdp |
− | * | + | * smiles: |
− | ** | + | ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** ftdhdkpuhblbtl-shyzeuofsa-k |
− | * | + | * molecular-weight: |
− | ** | + | ** 384.155 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ATDCD]] |
− | + | * [[ATDCDm]] | |
− | * [[ | + | * [[DCDPKIN-RXN]] |
− | * | + | * [[DCTPtm]] |
− | * | + | * [[RXN-14187]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[ATDCM]] | |
− | * | + | * [[CDPREDUCT-RXN]] |
− | * [[RXN | + | * [[DCDT]] |
− | * | + | * [[DCTCP]] |
− | * | + | * [[DCTPtm]] |
− | + | * [[DCTUP]] | |
− | * [[ | + | * [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]] |
− | + | * [[RXN-14216]] | |
− | * [[ | + | * [[RXN-7913]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | {{#set: common-name=dcdp}} |
− | + | {{#set: inchi-key=inchikey=ftdhdkpuhblbtl-shyzeuofsa-k}} | |
− | + | {{#set: molecular-weight=384.155}} | |
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite DCDP
- common-name:
- dcdp
- smiles:
- c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
- inchi-key:
- ftdhdkpuhblbtl-shyzeuofsa-k
- molecular-weight:
- 384.155