Difference between revisions of "5-L-GLUTAMYL-L-AMINO-ACID"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07752 == * transcription-direction: ** positive * right-end-position: ** 355429 * left-end-position: ** 337285 * centisome-position: ** 75.1796...") |
(Created page with "Category:metabolite == Metabolite CPD-14392 == * common-name: ** stearidonoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-14392 == |
− | * | + | * common-name: |
− | ** | + | ** stearidonoyl-coa |
− | + | * smiles: | |
− | * | + | ** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | + | * inchi-key: | |
− | ** | + | ** ddhcsalwdprvcn-uswkvxsksa-j |
− | + | * molecular-weight: | |
− | + | ** 1021.905 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-13426]] | |
− | + | * [[RXN-16041]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=stearidonoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=ddhcsalwdprvcn-uswkvxsksa-j}} | |
− | + | {{#set: molecular-weight=1021.905}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-14392
- common-name:
- stearidonoyl-coa
- smiles:
- ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- ddhcsalwdprvcn-uswkvxsksa-j
- molecular-weight:
- 1021.905