Difference between revisions of "5-L-GLUTAMYL-L-AMINO-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07752 == * transcription-direction: ** positive * right-end-position: ** 355429 * left-end-position: ** 337285 * centisome-position: ** 75.1796...")
(Created page with "Category:metabolite == Metabolite CPD-14392 == * common-name: ** stearidonoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ07752 ==
+
== Metabolite CPD-14392 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** stearidonoyl-coa
−
* right-end-position:
+
* smiles:
−
** 355429
+
** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 337285
+
** ddhcsalwdprvcn-uswkvxsksa-j
−
* centisome-position:
+
* molecular-weight:
−
** 75.1796   
+
** 1021.905
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-13426]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-16041]]
−
* [[3.1.1.23-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=stearidonoyl-coa}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ddhcsalwdprvcn-uswkvxsksa-j}}
−
* [[3.1.1.64-RXN]]
+
{{#set: molecular-weight=1021.905}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[CARBOXYLESTERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[LYSOPHOSPHOLIPASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10711]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10767]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12252]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12575]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15035]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15088]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15089]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXNQT-4366]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[LIPAS-PWY]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6303]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6857]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7409]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7420]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=355429}}
 
−
{{#set: left-end-position=337285}}
 
−
{{#set: centisome-position=75.1796    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=13}}
 
−
{{#set: nb pathway associated=5}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-14392

  • common-name:
    • stearidonoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ddhcsalwdprvcn-uswkvxsksa-j
  • molecular-weight:
    • 1021.905

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5-L-GLUTAMYL-L-AMINO-ACID&oldid=46338"