Difference between revisions of "Stearoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12237 == * transcription-direction: ** negative * right-end-position: ** 196218 * left-end-position: ** 175413 * centisome-position: ** 48.70608...") |
(Created page with "Category:metabolite == Metabolite RIBOSE-1-ARSENATE == * common-name: ** ribose-1-arsenate * smiles: ** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1) * inchi-key: ** ryjjomqpaa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite RIBOSE-1-ARSENATE == |
− | * | + | * common-name: |
− | ** | + | ** ribose-1-arsenate |
− | * | + | * smiles: |
− | ** | + | ** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1) |
− | * | + | * inchi-key: |
− | ** | + | ** ryjjomqpaaufbf-txicztdvsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 272.043 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-7001]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=ribose-1-arsenate}} | |
− | + | {{#set: inchi-key=inchikey=ryjjomqpaaufbf-txicztdvsa-l}} | |
− | + | {{#set: molecular-weight=272.043}} | |
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite RIBOSE-1-ARSENATE
- common-name:
- ribose-1-arsenate
- smiles:
- c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
- inchi-key:
- ryjjomqpaaufbf-txicztdvsa-l
- molecular-weight:
- 272.043