Difference between revisions of "CPD-13393"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21933 == * transcription-direction: ** negative * right-end-position: ** 93975 * left-end-position: ** 86901 * centisome-position: ** 47.36188...") |
(Created page with "Category:metabolite == Metabolite CPD-8090 == * common-name: ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-8090 == |
− | * | + | * common-name: |
− | ** | + | ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine |
− | + | * smiles: | |
− | + | ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o | |
− | + | * inchi-key: | |
− | * | + | ** qfdyidgukxrpkh-vslglsmxsa-n |
− | + | * molecular-weight: | |
− | ** | + | ** 780.076 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-8331]] | |
− | = | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-8323]] | |
− | + | * [[RXN-8330]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=1-α-linolenoyl-2-linoleoyl-phosphatidylcholine}} | |
− | + | {{#set: inchi-key=inchikey=qfdyidgukxrpkh-vslglsmxsa-n}} | |
− | * | + | {{#set: molecular-weight=780.076}} |
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-8090
- common-name:
- 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- qfdyidgukxrpkh-vslglsmxsa-n
- molecular-weight:
- 780.076