Difference between revisions of "GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19026 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.4.22.15-RXN ** Categ...") |
(Created page with "Category:metabolite == Metabolite CPD-12601 == * common-name: ** β-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-rwopyejcsa-n...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12601 == |
− | == | + | * common-name: |
− | * [[ | + | ** β-d-mannopyranose |
− | == Reaction(s) | + | * smiles: |
− | + | ** c(o)c1(c(o)c(o)c(o)c(o)o1) | |
− | + | * inchi-key: | |
− | + | ** wqzgkkkjijffok-rwopyejcsa-n | |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 180.157 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=β-d-mannopyranose}} | ||
+ | {{#set: inchi-key=inchikey=wqzgkkkjijffok-rwopyejcsa-n}} | ||
+ | {{#set: molecular-weight=180.157}} |
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-12601
- common-name:
- β-d-mannopyranose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o)o1)
- inchi-key:
- wqzgkkkjijffok-rwopyejcsa-n
- molecular-weight:
- 180.157