Difference between revisions of "PROTEIN-C-TERMINAL-S-ETC-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07909 == * transcription-direction: ** positive * right-end-position: ** 49612 * left-end-position: ** 35781 * centisome-position: ** 7.9968443...")
(Created page with "Category:metabolite == Metabolite CPD-19157 == * common-name: ** 3-oxo-(7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ07909 ==
+
== Metabolite CPD-19157 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-oxo-(7z)-tetradecenoyl-coa
−
* right-end-position:
+
* smiles:
−
** 49612
+
** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 35781
+
** bepllrgjvxaeji-twafkmgksa-j
−
* centisome-position:
+
* molecular-weight:
−
** 7.9968443   
+
** 985.829
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17795]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-17794]]
−
* [[ACOA120OR]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=3-oxo-(7z)-tetradecenoyl-coa}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=bepllrgjvxaeji-twafkmgksa-j}}
−
* [[ACOA140OR]]
+
{{#set: molecular-weight=985.829}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[ACOA160OR]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[ACOA40OR]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[ACOA80OR]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[ACYLCOADEHYDROG-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[FAO-PWY]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-5177]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[P162-PWY]]
 
−
** '''7''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-7401]]
 
−
** '''6''' reactions found over '''15''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=49612}}
 
−
{{#set: left-end-position=35781}}
 
−
{{#set: centisome-position=7.9968443    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=10}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-19157

  • common-name:
    • 3-oxo-(7z)-tetradecenoyl-coa
  • smiles:
    • ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • bepllrgjvxaeji-twafkmgksa-j
  • molecular-weight:
    • 985.829

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PROTEIN-C-TERMINAL-S-ETC-CYSTEINE&oldid=46395"