Difference between revisions of "5-DIPHOSPHO-1D-MYO-INOSITOL-12346P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16429 == * transcription-direction: ** positive * right-end-position: ** 520885 * left-end-position: ** 503802 * centisome-position: ** 73.249504...") |
(Created page with "Category:metabolite == Metabolite CPD-11402 == * common-name: ** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide * smiles: ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11402 == |
− | * | + | * common-name: |
− | ** | + | ** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide |
− | * | + | * smiles: |
− | ** | + | ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c=c3))) |
− | * | + | * inchi-key: |
− | ** | + | ** lqmbvwcqwfepfk-dkbymcrtsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 826.095 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-10609]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide}} | |
− | + | {{#set: inchi-key=inchikey=lqmbvwcqwfepfk-dkbymcrtsa-m}} | |
− | {{#set: | + | {{#set: molecular-weight=826.095}} |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-11402
- common-name:
- 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide
- smiles:
- c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c=c3)))
- inchi-key:
- lqmbvwcqwfepfk-dkbymcrtsa-m
- molecular-weight:
- 826.095