Difference between revisions of "CPD-18077"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04582 == * transcription-direction: ** positive * right-end-position: ** 61635 * left-end-position: ** 33796 * centisome-position: ** 32.18452...")
(Created page with "Category:metabolite == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == * common-name: ** (2r,3s)-3-isopropylmalate * smiles: ** cc(c)c(c([o-])=o)c(c([o-])=o)o * inch...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ04582 ==
+
== Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (2r,3s)-3-isopropylmalate
−
* right-end-position:
+
* smiles:
−
** 61635
+
** cc(c)c(c([o-])=o)c(c([o-])=o)o
−
* left-end-position:
+
* inchi-key:
−
** 33796
+
** rnqhmtfbussbjq-crclsjgqsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 32.18452   
+
** 174.153
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
−
== Reaction(s) associated ==
+
* [[IMDH]]
−
* [[6PFRUCTPHOS-RXN]]
+
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
−
** Category: [[annotation]]
+
* [[RXN-13158]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13163]]
−
** Category: [[orthology]]
+
* [[RXN-8991]]
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-13163]]
−
* [[PFK_]]
+
* [[RXN-8991]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=(2r,3s)-3-isopropylmalate}}
−
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=rnqhmtfbussbjq-crclsjgqsa-l}}
−
* [[PWY-1861]]
+
{{#set: molecular-weight=174.153}}
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5484]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-1042]]
 
−
** '''9''' reactions found over '''10''' reactions in the full pathway
 
−
* [[GLYCOLYSIS]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-7385]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[ANAGLYCOLYSIS-PWY]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=61635}}
 
−
{{#set: left-end-position=33796}}
 
−
{{#set: centisome-position=32.18452    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=6}}
 

Revision as of 20:32, 18 December 2020

Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE

  • common-name:
    • (2r,3s)-3-isopropylmalate
  • smiles:
    • cc(c)c(c([o-])=o)c(c([o-])=o)o
  • inchi-key:
    • rnqhmtfbussbjq-crclsjgqsa-l
  • molecular-weight:
    • 174.153

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-18077&oldid=46407"