Difference between revisions of "CPD0-1162"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15126 == * transcription-direction: ** negative * right-end-position: ** 140593 * left-end-position: ** 132646 * centisome-position: ** 44.06112...") |
(Created page with "Category:metabolite == Metabolite FERULOYL-COA == * common-name: ** feruloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite FERULOYL-COA == |
− | * | + | * common-name: |
− | ** | + | ** feruloyl-coa |
− | + | * smiles: | |
− | * | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] |
− | + | * inchi-key: | |
− | ** | + | ** gbxzvjqqdajgso-nbxnmegssa-j |
− | + | * molecular-weight: | |
− | + | ** 939.674 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-1106]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | * [[6.2.1.34-RXN]] | |
− | + | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=feruloyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=gbxzvjqqdajgso-nbxnmegssa-j}} | |
− | + | {{#set: molecular-weight=939.674}} | |
− | * | ||
− | |||
− | ** | ||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite FERULOYL-COA
- common-name:
- feruloyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- gbxzvjqqdajgso-nbxnmegssa-j
- molecular-weight:
- 939.674