Difference between revisions of "CPD0-1162"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15126 == * transcription-direction: ** negative * right-end-position: ** 140593 * left-end-position: ** 132646 * centisome-position: ** 44.06112...")
(Created page with "Category:metabolite == Metabolite FERULOYL-COA == * common-name: ** feruloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ15126 ==
+
== Metabolite FERULOYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** feruloyl-coa
−
* right-end-position:
+
* smiles:
−
** 140593
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 132646
+
** gbxzvjqqdajgso-nbxnmegssa-j
−
* centisome-position:
+
* molecular-weight:
−
** 44.06112   
+
** 939.674
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-1106]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[ADENPRIBOSYLTRAN-RXN]]
+
* [[6.2.1.34-RXN]]
−
** Category: [[annotation]]
+
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=feruloyl-coa}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=gbxzvjqqdajgso-nbxnmegssa-j}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=939.674}}
−
* [[APPRT]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[GUANPRIBOSYLTRAN-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-14270]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7807]]
 
−
** '''2''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6610]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7805]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-6605]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[P121-PWY]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6599]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6620]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=140593}}
 
−
{{#set: left-end-position=132646}}
 
−
{{#set: centisome-position=44.06112    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=7}}
 

Revision as of 20:32, 18 December 2020

Metabolite FERULOYL-COA

  • common-name:
    • feruloyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • gbxzvjqqdajgso-nbxnmegssa-j
  • molecular-weight:
    • 939.674

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD0-1162&oldid=46408"