Difference between revisions of "UDP-SULFOQUINOVOSE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14370 == * transcription-direction: ** positive * right-end-position: ** 670769 * left-end-position: ** 658968 * centisome-position: ** 91.89103...") |
(Created page with "Category:metabolite == Metabolite CPD-12128 == * common-name: ** menaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12128 == |
| − | * | + | * common-name: |
| − | ** | + | ** menaquinol-11 |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c |
| − | * | + | * inchi-key: |
| − | ** | + | ** zxhqkrgmwkzwgn-ryzszpjesa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 923.499 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-9362]] |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=menaquinol-11}} | |
| − | + | {{#set: inchi-key=inchikey=zxhqkrgmwkzwgn-ryzszpjesa-n}} | |
| − | + | {{#set: molecular-weight=923.499}} | |
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-12128
- common-name:
- menaquinol-11
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
- inchi-key:
- zxhqkrgmwkzwgn-ryzszpjesa-n
- molecular-weight:
- 923.499
