Difference between revisions of "2-KETO-GLUTARAMATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02307 == * transcription-direction: ** negative * right-end-position: ** 16857 * left-end-position: ** 7832 * centisome-position: ** 5.6498966...") |
(Created page with "Category:metabolite == Metabolite O-SINAPOYLCHOLINE == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c * inchi-key: ** hu...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite O-SINAPOYLCHOLINE == |
− | * | + | * common-name: |
− | ** | + | ** o-sinapoylcholine |
− | * | + | * smiles: |
− | ** | + | ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c |
− | * | + | * inchi-key: |
− | ** | + | ** hujxhfrxwwgyqh-uhfffaoysa-o |
− | * | + | * molecular-weight: |
− | ** | + | ** 310.369 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[2.3.1.91-RXN]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=o-sinapoylcholine}} | |
− | + | {{#set: inchi-key=inchikey=hujxhfrxwwgyqh-uhfffaoysa-o}} | |
− | + | {{#set: molecular-weight=310.369}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite O-SINAPOYLCHOLINE
- common-name:
- o-sinapoylcholine
- smiles:
- c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
- inchi-key:
- hujxhfrxwwgyqh-uhfffaoysa-o
- molecular-weight:
- 310.369