Difference between revisions of "METHYLARSONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16766 == * transcription-direction: ** negative * right-end-position: ** 680631 * left-end-position: ** 678270 * centisome-position: ** 99.44681...")
(Created page with "Category:metabolite == Metabolite CPD-15838 == * common-name: ** γ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c * inchi-key: *...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16766 ==
+
== Metabolite CPD-15838 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** γ-tocotrienol
−
* right-end-position:
+
* smiles:
−
** 680631
+
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c
−
* left-end-position:
+
* inchi-key:
−
** 678270
+
** otxntmvvoobzcv-wazjvijmsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 99.44681   
+
** 410.639
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14918]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[DISULFOXRED-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=γ-tocotrienol}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=otxntmvvoobzcv-wazjvijmsa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=410.639}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-982]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-4621]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-4202]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=680631}}
 
−
{{#set: left-end-position=678270}}
 
−
{{#set: centisome-position=99.44681    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-15838

  • common-name:
    • γ-tocotrienol
  • smiles:
    • cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c
  • inchi-key:
    • otxntmvvoobzcv-wazjvijmsa-n
  • molecular-weight:
    • 410.639

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=METHYLARSONATE&oldid=46623"