Difference between revisions of "R-1-AMINOPROPAN-2-YL-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01675 == * transcription-direction: ** negative * right-end-position: ** 125317 * left-end-position: ** 112874 * centisome-position: ** 76.9536...") |
(Created page with "Category:metabolite == Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE == * common-name: ** (r)-1-amino-2-propanol o-2-phosphate * smiles: ** cc(c[n+])op(=o)([o-])[o-] * inchi-k...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE == |
− | * | + | * common-name: |
− | ** | + | ** (r)-1-amino-2-propanol o-2-phosphate |
− | * | + | * smiles: |
− | ** | + | ** cc(c[n+])op(=o)([o-])[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** ybolzujjguzudc-gsvougtgsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 154.082 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[4.1.1.81-RXN]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=(r)-1-amino-2-propanol o-2-phosphate}} | |
− | + | {{#set: inchi-key=inchikey=ybolzujjguzudc-gsvougtgsa-m}} | |
− | + | {{#set: molecular-weight=154.082}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE
- common-name:
- (r)-1-amino-2-propanol o-2-phosphate
- smiles:
- cc(c[n+])op(=o)([o-])[o-]
- inchi-key:
- ybolzujjguzudc-gsvougtgsa-m
- molecular-weight:
- 154.082