Difference between revisions of "CPD-13014"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04996 == * transcription-direction: ** negative * right-end-position: ** 102342 * left-end-position: ** 90912 * centisome-position: ** 9.414747...") |
(Created page with "Category:metabolite == Metabolite CPD-12658 == * common-name: ** riboflavin cyclic-4',5'-phosphate * smiles: ** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12658 == |
− | * | + | * common-name: |
− | ** | + | ** riboflavin cyclic-4',5'-phosphate |
− | + | * smiles: | |
− | + | ** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4))) | |
− | * | + | * inchi-key: |
− | ** | + | ** cvzkydyrjqyydj-mbnywofbsa-m |
− | + | * molecular-weight: | |
− | + | ** 437.325 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11695]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-11695]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=riboflavin cyclic-4',5'-phosphate}} | |
− | + | {{#set: inchi-key=inchikey=cvzkydyrjqyydj-mbnywofbsa-m}} | |
− | ** | + | {{#set: molecular-weight=437.325}} |
− | |||
− | |||
− | * | ||
− | ** | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-12658
- common-name:
- riboflavin cyclic-4',5'-phosphate
- smiles:
- cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4)))
- inchi-key:
- cvzkydyrjqyydj-mbnywofbsa-m
- molecular-weight:
- 437.325