Difference between revisions of "GALACTOSE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18543 == * transcription-direction: ** positive * right-end-position: ** 28263 * left-end-position: ** 2053 * centisome-position: ** 0.8459735...") |
(Created page with "Category:metabolite == Metabolite CPD-11523 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(o)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11523 == |
− | * | + | * common-name: |
− | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa |
− | * | + | * smiles: |
− | ** | + | ** ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o) |
− | * | + | * inchi-key: |
− | ** | + | ** omdqviuydjawhx-qhzcmhftsa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 1027.866 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-10702]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-10704]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=omdqviuydjawhx-qhzcmhftsa-j}} |
− | + | {{#set: molecular-weight=1027.866}} | |
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-11523
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
- inchi-key:
- omdqviuydjawhx-qhzcmhftsa-j
- molecular-weight:
- 1027.866