Difference between revisions of "3-UREIDO-ISOBUTYRATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04268 == * transcription-direction: ** positive * right-end-position: ** 104185 * left-end-position: ** 98364 * centisome-position: ** 90.576256...")
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-hexaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ04268 ==
+
== Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ==
* transcription-direction:
+
* common-name:
** positive
+
** all-trans-hexaprenyl diphosphate
* right-end-position:
+
* smiles:
** 104185
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
* left-end-position:
+
* inchi-key:
** 98364
+
** ngfsmhkftzrokj-mmszmyibsa-k
* centisome-position:
+
* molecular-weight:
** 90.576256   
+
** 583.66
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-9003]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=all-trans-hexaprenyl diphosphate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ngfsmhkftzrokj-mmszmyibsa-k}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=583.66}}
{{#set: right-end-position=104185}}
 
{{#set: left-end-position=98364}}
 
{{#set: centisome-position=90.576256    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:33, 18 December 2020

Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE

  • common-name:
    • all-trans-hexaprenyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • ngfsmhkftzrokj-mmszmyibsa-k
  • molecular-weight:
    • 583.66

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality