Difference between revisions of "CPD-8890"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11751 == * transcription-direction: ** negative * right-end-position: ** 207893 * left-end-position: ** 199791 * centisome-position: ** 54.41346...") |
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-4209 == |
− | * | + | * common-name: |
− | ** | + | ** n6-dimethylallyladenine |
− | * | + | * smiles: |
− | ** | + | ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) |
− | * | + | * inchi-key: |
− | ** | + | ** hyvabzigrdekcd-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 203.246 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[1.5.99.12-RXN]] |
− | == Reaction(s) | + | * [[RXN-4315]] |
− | * [[RXN | + | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] |
− | * | + | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * [[RXN- | + | * [[1.5.99.12-RXN]] |
− | * | + | * [[RXN-4313]] |
− | * | + | * [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]] |
− | == | + | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] |
− | + | * [[RXN-4315]] | |
− | + | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] | |
− | {{#set: | + | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=n6-dimethylallyladenine}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}} |
− | + | {{#set: molecular-weight=203.246}} | |
− | |||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-4209
- common-name:
- n6-dimethylallyladenine
- smiles:
- cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
- inchi-key:
- hyvabzigrdekcd-uhfffaoysa-n
- molecular-weight:
- 203.246
Reaction(s) known to consume the compound
- 1.5.99.12-RXN
- RXN-4315
- RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.
- RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.
Reaction(s) known to produce the compound
- 1.5.99.12-RXN
- RXN-4313
- RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.
- RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.
- RXN-4315
- RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.
- RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.