Difference between revisions of "CPD-8890"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11751 == * transcription-direction: ** negative * right-end-position: ** 207893 * left-end-position: ** 199791 * centisome-position: ** 54.41346...")
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11751 ==
+
== Metabolite CPD-4209 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** n6-dimethylallyladenine
−
* right-end-position:
+
* smiles:
−
** 207893
+
** cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
−
* left-end-position:
+
* inchi-key:
−
** 199791
+
** hyvabzigrdekcd-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 54.41346   
+
** 203.246
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.5.99.12-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-4315]]
−
* [[RXN-8344]]
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
−
** Category: [[annotation]]
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-8348]]
+
* [[1.5.99.12-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-4313]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
−
== Pathway(s) associated ==
+
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
−
* [[PWY-6823]]
+
* [[RXN-4315]]
−
** '''7''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
−
{{#set: transcription-direction=negative}}
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
−
{{#set: right-end-position=207893}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: left-end-position=199791}}
+
{{#set: common-name=n6-dimethylallyladenine}}
−
{{#set: centisome-position=54.41346    }}
+
{{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}}
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: molecular-weight=203.246}}
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-4209

  • common-name:
    • n6-dimethylallyladenine
  • smiles:
    • cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
  • inchi-key:
    • hyvabzigrdekcd-uhfffaoysa-n
  • molecular-weight:
    • 203.246

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8890&oldid=46803"