Difference between revisions of "CPD-409"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08165 == * transcription-direction: ** positive * right-end-position: ** 217568 * left-end-position: ** 213310 * centisome-position: ** 47.962963...")
(Created page with "Category:metabolite == Metabolite CPD-11241 == * common-name: ** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate * smiles: ** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ08165 ==
+
== Metabolite CPD-11241 ==
* transcription-direction:
+
* common-name:
** positive
+
** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
* right-end-position:
+
* smiles:
** 217568
+
** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
* left-end-position:
+
* inchi-key:
** 213310
+
** llvvmxfnkahvez-gawnparcsa-l
* centisome-position:
+
* molecular-weight:
** 47.962963   
+
** 350.235
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-14897]]
* [[5.3.4.1-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=llvvmxfnkahvez-gawnparcsa-l}}
* [[DISULISOM-RXN]]
+
{{#set: molecular-weight=350.235}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=217568}}
 
{{#set: left-end-position=213310}}
 
{{#set: centisome-position=47.962963    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-11241

  • common-name:
    • 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
  • smiles:
    • c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
  • inchi-key:
    • llvvmxfnkahvez-gawnparcsa-l
  • molecular-weight:
    • 350.235

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality