Difference between revisions of "3-UREIDO-PROPIONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03279 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...")
(Created page with "Category:metabolite == Metabolite CPD-19489 == * common-name: ** 3-isopropyl-8-(methylthio)-2-oxooctanoate * smiles: ** cscccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: ** y...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ03279 ==
+
== Metabolite CPD-19489 ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** 3-isopropyl-8-(methylthio)-2-oxooctanoate
== Reaction(s) associated ==
+
* smiles:
* [[PROTEIN-KINASE-RXN]]
+
** cscccccc(c(=o)c(=o)[o-])c(=o)[o-]
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** yobcouzbifvtfn-uhfffaoysa-l
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
{{#set: nb reaction associated=1}}
+
** 246.278
 +
== Reaction(s) known to consume the compound ==
 +
* [[RXN-18204]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[RXN-18204]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3-isopropyl-8-(methylthio)-2-oxooctanoate}}
 +
{{#set: inchi-key=inchikey=yobcouzbifvtfn-uhfffaoysa-l}}
 +
{{#set: molecular-weight=246.278}}

Revision as of 20:33, 18 December 2020

Metabolite CPD-19489

  • common-name:
    • 3-isopropyl-8-(methylthio)-2-oxooctanoate
  • smiles:
    • cscccccc(c(=o)c(=o)[o-])c(=o)[o-]
  • inchi-key:
    • yobcouzbifvtfn-uhfffaoysa-l
  • molecular-weight:
    • 246.278

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality