Difference between revisions of "CPD-14159"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04223 == * transcription-direction: ** negative * right-end-position: ** 108409 * left-end-position: ** 101345 * centisome-position: ** 92.71932...") |
(Created page with "Category:metabolite == Metabolite PANTOTHENATE == * common-name: ** (r)-pantothenate * smiles: ** cc(c)(co)c(o)c(=o)nccc(=o)[o-] * inchi-key: ** ghokwgtuzjeaqd-zetcqymhsa-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PANTOTHENATE == |
| − | * | + | * common-name: |
| − | ** | + | ** (r)-pantothenate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)(co)c(o)c(=o)nccc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** ghokwgtuzjeaqd-zetcqymhsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 218.229 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[PANTOTHENATE-KIN-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | * [[PANTOATE-BETA-ALANINE-LIG-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=(r)-pantothenate}} | |
| − | + | {{#set: inchi-key=inchikey=ghokwgtuzjeaqd-zetcqymhsa-m}} | |
| − | + | {{#set: molecular-weight=218.229}} | |
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite PANTOTHENATE
- common-name:
- (r)-pantothenate
- smiles:
- cc(c)(co)c(o)c(=o)nccc(=o)[o-]
- inchi-key:
- ghokwgtuzjeaqd-zetcqymhsa-m
- molecular-weight:
- 218.229
