Difference between revisions of "Poly-D-galactosamine"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07838 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-10745 ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-10664 == * common-name: ** 5-methylsalicylate * smiles: ** cc1(=cc(=c(c=c1)o)c([o-])=o) * inchi-key: ** dlgbegbhxsaqoc-uhfffaoysa-m *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-10664 == |
− | == | + | * common-name: |
− | * | + | ** 5-methylsalicylate |
− | == Reaction(s) | + | * smiles: |
− | * [[RXN- | + | ** cc1(=cc(=c(c=c1)o)c([o-])=o) |
− | + | * inchi-key: | |
− | + | ** dlgbegbhxsaqoc-uhfffaoysa-m | |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 151.141 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10079]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=5-methylsalicylate}} | ||
+ | {{#set: inchi-key=inchikey=dlgbegbhxsaqoc-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=151.141}} |
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-10664
- common-name:
- 5-methylsalicylate
- smiles:
- cc1(=cc(=c(c=c1)o)c([o-])=o)
- inchi-key:
- dlgbegbhxsaqoc-uhfffaoysa-m
- molecular-weight:
- 151.141