Difference between revisions of "L-ALPHA-AMINO-EPSILON-KETO-PIMELATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18765 == * transcription-direction: ** negative * right-end-position: ** 167790 * left-end-position: ** 159574 * centisome-position: ** 67.5094...") |
(Created page with "Category:metabolite == Metabolite CPD-4821 == * common-name: ** kanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-4821 == |
− | * | + | * common-name: |
− | ** | + | ** kanamycin a |
− | * | + | * smiles: |
− | ** | + | ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+])) |
− | * | + | * inchi-key: |
− | ** | + | ** sbujhosqtjfqjx-noamyhissa-r |
− | * | + | * molecular-weight: |
− | ** | + | ** 488.534 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-13167]] |
− | == Reaction(s) | + | * [[RXN-15285]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=kanamycin a}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=sbujhosqtjfqjx-noamyhissa-r}} |
− | {{#set: | + | {{#set: molecular-weight=488.534}} |
− | |||
− | {{#set: | ||
− | |||
− |
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-4821
- common-name:
- kanamycin a
- smiles:
- c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- sbujhosqtjfqjx-noamyhissa-r
- molecular-weight:
- 488.534