Difference between revisions of "Phospholipids"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08877 == * transcription-direction: ** positive * right-end-position: ** 416711 * left-end-position: ** 406959 * centisome-position: ** 94.57059...") |
(Created page with "Category:metabolite == Metabolite CPD-17372 == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-17372 == |
| − | * | + | * common-name: |
| − | ** | + | ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o |
| − | * | + | * inchi-key: |
| − | ** | + | ** gfjkjlhwwzxdau-kxfgnqbasa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 450.508 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16118]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-16117]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=gfjkjlhwwzxdau-kxfgnqbasa-l}} |
| − | + | {{#set: molecular-weight=450.508}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-17372
- common-name:
- 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
- smiles:
- c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
- inchi-key:
- gfjkjlhwwzxdau-kxfgnqbasa-l
- molecular-weight:
- 450.508
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-[18-hydroxyoleyl]-2-lyso-phosphatidate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
