Difference between revisions of "D-2-hydroxyacids"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01779 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.4.21.89-RXN ** Categ...") |
(Created page with "Category:metabolite == Metabolite CPD-253 == * common-name: ** 4,5-seco-dopa * smiles: ** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o * inchi-key: ** fnegjfdtwwxqes-qtwonpp...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-253 == |
| − | + | * common-name: | |
| − | * | + | ** 4,5-seco-dopa |
| − | + | * smiles: | |
| − | * | + | ** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o |
| − | * | + | * inchi-key: |
| − | ** | + | ** fnegjfdtwwxqes-qtwonppnsa-m |
| − | * | + | * molecular-weight: |
| − | * | + | ** 228.181 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-8460]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=4,5-seco-dopa}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=fnegjfdtwwxqes-qtwonppnsa-m}} |
| − | {{#set: | + | {{#set: molecular-weight=228.181}} |
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-253
- common-name:
- 4,5-seco-dopa
- smiles:
- c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o
- inchi-key:
- fnegjfdtwwxqes-qtwonppnsa-m
- molecular-weight:
- 228.181
