Difference between revisions of "IS30-Insertion-Sequences"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PBDHh G6PBDHh] == * direction: ** left-to-right * common-name: ** glucose 6-phosphate dehydrogena...")
(Created page with "Category:metabolite == Metabolite CPD-7246 == * common-name: ** n-acetyl-α-d-galactosamine 1-phosphate * smiles: ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o * i...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PBDHh G6PBDHh] ==
+
== Metabolite CPD-7246 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** glucose 6-phosphate dehydrogenase (g6p-b)
+
** n-acetyl-α-d-galactosamine 1-phosphate
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[GLC-6-P]][h] '''+''' 1.0 [[NADP]][h] '''=>''' 1.0 [[D-6-P-GLUCONO-DELTA-LACTONE]][h] '''+''' 1.0 [[NADPH]][h] '''+''' 1.0 [[PROTON]][h]
+
** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ09952]]
+
** fzljpepaypummr-jajwtyfosa-l
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 299.174
−
* Gene: [[SJ11913]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[RXN-13760]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-13760]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=n-acetyl-α-d-galactosamine 1-phosphate}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=fzljpepaypummr-jajwtyfosa-l}}
−
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=299.174}}
−
{{#set: common-name=glucose 6-phosphate dehydrogenase (g6p-b)}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-7246

  • common-name:
    • n-acetyl-α-d-galactosamine 1-phosphate
  • smiles:
    • cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o
  • inchi-key:
    • fzljpepaypummr-jajwtyfosa-l
  • molecular-weight:
    • 299.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=IS30-Insertion-Sequences&oldid=47226"