Difference between revisions of "Methionine-synthase-cob-II-alamins"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04393 == * transcription-direction: ** positive * right-end-position: ** 12820 * left-end-position: ** 7673 * centisome-position: ** 7.1205845...") |
(Created page with "Category:metabolite == Metabolite S-ADENOSYLMETHIONINAMINE == * common-name: ** s-adenosyl 3-(methylthio)propylamine * smiles: ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite S-ADENOSYLMETHIONINAMINE == |
− | * | + | * common-name: |
− | ** | + | ** s-adenosyl 3-(methylthio)propylamine |
− | + | * smiles: | |
− | * | + | ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) |
− | + | * inchi-key: | |
− | ** | + | ** zunbitixdcpnsd-lsrjevitsa-o |
− | + | * molecular-weight: | |
− | + | ** 356.442 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[APAPT]] | |
− | == | + | * [[RXN-11190]] |
− | + | * [[RXN0-5217]] | |
− | * | + | * [[SPERMIDINESYN-RXN]] |
− | + | * [[SPERMINE-SYNTHASE-RXN]] | |
− | ** | + | == Reaction(s) known to produce the compound == |
− | + | * [[AMCL]] | |
− | + | * [[RXN-11190]] | |
− | + | * [[SAMDECARB-RXN]] | |
− | + | * [[SPERMIDINESYN-RXN]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=s-adenosyl 3-(methylthio)propylamine}} | |
− | + | {{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}} | |
− | + | {{#set: molecular-weight=356.442}} | |
− | ** | ||
− | |||
− | * | ||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN0- | ||
− | * | ||
− | * | ||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:34, 18 December 2020
Contents
Metabolite S-ADENOSYLMETHIONINAMINE
- common-name:
- s-adenosyl 3-(methylthio)propylamine
- smiles:
- c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
- inchi-key:
- zunbitixdcpnsd-lsrjevitsa-o
- molecular-weight:
- 356.442