Difference between revisions of "CPD-13227"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12736 == * transcription-direction: ** negative * right-end-position: ** 147811 * left-end-position: ** 141562 * centisome-position: ** 19.058352...")
(Created page with "Category:metabolite == Metabolite CPD-13118 == * common-name: ** gdp-β-l-fucose * smiles: ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12736 ==
+
== Metabolite CPD-13118 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** gdp-β-l-fucose
−
* right-end-position:
+
* smiles:
−
** 147811
+
** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
−
* left-end-position:
+
* inchi-key:
−
** 141562
+
** lqebexmhblqmdb-jgqubwhwsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 19.058352   
+
** 587.33
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.4.1.221-RXN]]
−
== Reaction(s) associated ==
+
* [[2.4.1.68-RXN]]
−
* [[PROTEIN-KINASE-RXN]]
+
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
−
** Category: [[annotation]]
+
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-9463]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[1.1.1.271-RXN]]
−
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
+
* [[2.4.1.221-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=gdp-β-l-fucose}}
−
* [[RXN-8443]]
+
{{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=587.33}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5381]]
 
−
** '''6''' reactions found over '''11''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=147811}}
 
−
{{#set: left-end-position=141562}}
 
−
{{#set: centisome-position=19.058352    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-13118

  • common-name:
    • gdp-β-l-fucose
  • smiles:
    • cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
  • inchi-key:
    • lqebexmhblqmdb-jgqubwhwsa-l
  • molecular-weight:
    • 587.33

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13227&oldid=47266"