Difference between revisions of "CPD-148"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05117 == * transcription-direction: ** positive * right-end-position: ** 17078 * left-end-position: ** 11895 * centisome-position: ** 12.326552...") |
(Created page with "Category:metabolite == Metabolite FRU1P == * common-name: ** β-d-fructofuranose 1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1) * inchi-key: ** rhk...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite FRU1P == |
| − | * | + | * common-name: |
| − | ** | + | ** β-d-fructofuranose 1-phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** rhkkzbwrnhgjez-arqdhwqxsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 258.121 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8631]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=β-d-fructofuranose 1-phosphate}} | |
| − | + | {{#set: inchi-key=inchikey=rhkkzbwrnhgjez-arqdhwqxsa-l}} | |
| − | + | {{#set: molecular-weight=258.121}} | |
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:34, 18 December 2020
Contents
Metabolite FRU1P
- common-name:
- β-d-fructofuranose 1-phosphate
- smiles:
- c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1)
- inchi-key:
- rhkkzbwrnhgjez-arqdhwqxsa-l
- molecular-weight:
- 258.121
